| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:26:43 UTC |
|---|
| Update Date | 2025-03-21 18:39:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00126360 |
|---|
| Frequency | 20.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H16O7 |
|---|
| Molecular Mass | 380.0896 |
|---|
| SMILES | O=C(O)C1OC(Oc2ccc3ccc4cccc5ccc2c3c45)OC(O)C1O |
|---|
| InChI Key | FSEMXJVSNKHYDX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | pyrenes |
|---|
| Subclass | pyrenes |
|---|
| Direct Parent | pyrenes |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,3-dioxanesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid orthoesterscarboxylic acidshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesnaphthalenesorganic oxidesortho estersoxacyclic compoundsphenanthrenes and derivativesphenol etherssecondary alcohols |
|---|
| Substituents | phenol ethercarbonyl groupcarboxylic acidortho estercarboxylic acid orthoestercarboxylic acid derivativebeta-hydroxy acidorganic oxidearomatic heteropolycyclic compoundhemiacetalorthocarboxylic acid derivativeorganoheterocyclic compoundalcoholphenanthrenehydroxy acidoxacyclepyrenemonocarboxylic acid or derivativesnaphthaleneorganic oxygen compoundsecondary alcoholhydrocarbon derivativemeta-dioxaneorganooxygen compound |
|---|
