| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:26:43 UTC |
|---|
| Update Date | 2025-03-21 18:39:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00126372 |
|---|
| Frequency | 20.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H15NO8S |
|---|
| Molecular Mass | 369.0518 |
|---|
| SMILES | NS(=O)(=O)OC1Cc2cc(O)cc(O)c2OC1c1ccc(O)c(O)c1 |
|---|
| InChI Key | WHODOYVNPLRKLK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 8-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids4'-hydroxyflavonoids6-hydroxyflavonoidsalkyl aryl ethersbenzene and substituted derivativesflavan-3-olshydrocarbon derivativesorganic nitrogen compoundsorganic oxidesorganic sulfuric acids and derivativesoxacyclic compounds |
|---|
| Substituents | 8-hydroxyflavonoidmonocyclic benzene moietyether1-benzopyranflavan1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganic oxidearomatic heteropolycyclic compoundchromaneflavan-3-olorganoheterocyclic compoundbenzopyranorganic sulfuric acid or derivatives6-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacycleorganic oxygen compound4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
