| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:26:44 UTC |
|---|
| Update Date | 2025-03-21 18:39:35 UTC |
|---|
| HMDB ID | HMDB0038614 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00126409 |
|---|
| Name | gamma-L-Glutamyl-L-pipecolic acid |
|---|
| Frequency | 20.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H18N2O5 |
|---|
| Molecular Mass | 258.1216 |
|---|
| SMILES | NC(CCC(=O)N1CCCCC1C(=O)O)C(=O)O |
|---|
| InChI Key | MNEBDCWSYIPUDZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | dipeptides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesglutamine and derivativesheterocyclic fatty acidshydrocarbon derivativesmonoalkylaminesn-acylpiperidinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspiperidinecarboxylic acidstertiary carboxylic acid amides |
|---|
| Substituents | fatty acylcarbonyl groupcarboxylic acidglutamine or derivativesheterocyclic fatty acidfatty acidalpha-amino acid or derivativesorganic oxidetertiary carboxylic acid amidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundpiperidinecarboxylic acidpiperidineorganoheterocyclic compoundazacyclecarboxamide groupalpha-dipeptiden-acyl-piperidineorganic oxygen compounddicarboxylic acid or derivativeshydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
