Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-21 00:26:46 UTC |
---|
Update Date | 2025-03-21 18:39:35 UTC |
---|
HMDB ID | HMDB0061113 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00126471 |
---|
Name | Sulforaphane-N-acetylcysteine |
---|
Frequency | 20.2 |
---|
Structure | |
---|
Chemical Formula | C11H20N2O4S3 |
---|
Molecular Mass | 340.0585 |
---|
SMILES | CC(O)=NC(CSC(=S)NCCCCS(C)=O)C(=O)O |
---|
InChI Key | IIHBKTCHILXGOT-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | cysteine and derivatives |
---|
Geometric Descriptor | aliphatic acyclic compounds |
---|
Alternative Parents | alpha amino acidscarbonyl compoundscarboximidic acidscarboxylic acidsdithiocarbamic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundssulfenyl compoundssulfinyl compoundssulfoxides |
---|
Substituents | aliphatic acyclic compoundcarboximidic acidcarbonyl groupcarboxylic acidsulfenyl compoundorganic 1,3-dipolar compoundorganosulfur compoundpropargyl-type 1,3-dipolar organic compounddithiocarbamic acid esterorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsulfinyl compoundcysteine or derivativesorganonitrogen compoundsulfoxidealpha-amino acidorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
---|