| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:26:51 UTC |
|---|
| Update Date | 2025-03-21 18:39:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00126687 |
|---|
| Frequency | 20.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H10N5O6P |
|---|
| Molecular Mass | 315.0369 |
|---|
| SMILES | O=P1(O)OCC2OC(n3cnc4nncnc43)C(O)C2O1 |
|---|
| InChI Key | DNFAPAIFJYHYMA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2,4-triazinesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesmonosaccharidesn-substituted imidazolesorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | pentose phosphateorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycletetrahydrofuranheteroaromatic compoundoxacyclesecondary alcoholtriazinehydrocarbon derivativeorganic nitrogen compound1,2,4-triazineorganic phosphoric acid derivative |
|---|
