Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 00:26:56 UTC |
---|
Update Date | 2025-03-21 18:39:42 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00126888 |
---|
Frequency | 20.1 |
---|
Structure | |
---|
Chemical Formula | C9H12NO7P |
---|
Molecular Mass | 277.0351 |
---|
SMILES | COC(=O)c1c(COP(=O)(O)O)cnc(C)c1O |
---|
InChI Key | CXEIIOMFTOVYLT-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | pyridines and derivatives |
---|
Subclass | pyridinecarboxylic acids and derivatives |
---|
Direct Parent | pyridinecarboxylic acids |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | 2-halopyridinesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmethyl estersmethylpyridinesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspolyhalopyridinesvinylogous acids |
---|
Substituents | aromatic heteromonocyclic compoundpolyhalopyridinecarboxylic acid derivativeorganic oxidemethyl esterorganonitrogen compoundorganopnictogen compound2-halopyridineazacycleheteroaromatic compoundhydroxypyridinemethylpyridinevinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estermonoalkyl phosphatecarboxylic acid esterpyridine carboxylic acidhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
---|