| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:26:58 UTC |
|---|
| Update Date | 2025-03-21 18:39:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00126960 |
|---|
| Frequency | 20.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H6O7S |
|---|
| Molecular Mass | 245.9834 |
|---|
| SMILES | O=C(O)c1cccc(OS(=O)(=O)O)c(=O)c1 |
|---|
| InChI Key | ZDUAPMWULFUBKT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | arylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carboxylic acidscyclic ketonesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundssulfuric acid monoesterstropones |
|---|
| Substituents | sulfuric acid monoestertroponecarboxylic acidcyclic ketonecarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsulfate-esterhydrocarbon derivativearylsulfatesulfuric acid esterorganooxygen compound |
|---|
