| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:26:58 UTC |
|---|
| Update Date | 2025-03-21 18:39:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00126981 |
|---|
| Frequency | 20.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H12O3 |
|---|
| Molecular Mass | 240.0786 |
|---|
| SMILES | Oc1ccc2c(c1)-c1cc3c(cc1CC2)OCO3 |
|---|
| InChI Key | FEOCXXGHXXHCCO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetalsbenzodioxoleshydrocarbon derivativesnaphthols and derivativesorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | phenanthrene1-hydroxy-2-unsubstituted benzenoidoxacyclenaphthaleneorganic oxygen compoundacetalaromatic heteropolycyclic compoundhydrocarbon derivative2-naphtholorganoheterocyclic compoundorganooxygen compoundbenzodioxole |
|---|
