| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:27:03 UTC |
|---|
| Update Date | 2025-03-21 18:39:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00127168 |
|---|
| Frequency | 20.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H22O10 |
|---|
| Molecular Mass | 446.1213 |
|---|
| SMILES | OCC1OC(Oc2cc3cc(O)cc(O)c3cc2-c2ccc(O)c(O)c2)C(O)C(O)C1O |
|---|
| InChI Key | PPPAKOWWTZMDSZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | phenylnaphthalenes |
|---|
| Direct Parent | phenylnaphthalenes |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsbenzene and substituted derivativeshydrocarbon derivativesmonosaccharidesnaphthols and derivativesoxacyclic compoundsoxanesphenol ethersprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholphenol ethermonocyclic benzene moiety1-hydroxy-2-unsubstituted benzenoidmonosaccharide1-hydroxy-4-unsubstituted benzenoidoxacyclesaccharideorganic oxygen compoundacetalaromatic heteropolycyclic compoundphenylnaphthalenesecondary alcoholphenolhydrocarbon derivative1-naphtholoxaneprimary alcohol2-naphtholorganoheterocyclic compoundorganooxygen compound |
|---|
