| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:27:04 UTC |
|---|
| Update Date | 2025-03-21 18:39:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00127192 |
|---|
| Frequency | 20.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H12O9 |
|---|
| Molecular Mass | 252.0481 |
|---|
| SMILES | CC(=O)OC(C(=O)O)C(O)C(O)C(O)C(=O)O |
|---|
| InChI Key | KJFCOPQWGJKGOL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | glucuronic acid derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidshydrocarbon derivativesmonosaccharidesorganic oxidessecondary alcoholstricarboxylic acids and derivatives |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupcarboxylic acidglucuronic acid or derivativesalpha-hydroxy acidmonosaccharidetricarboxylic acid or derivativeshydroxy acidcarboxylic acid derivativebeta-hydroxy acidorganic oxidecarboxylic acid estersecondary alcoholhydrocarbon derivative |
|---|
