| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:27:05 UTC |
|---|
| Update Date | 2025-03-21 18:39:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00127257 |
|---|
| Frequency | 20.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12NO4PS |
|---|
| Molecular Mass | 261.0225 |
|---|
| SMILES | COP(O)(=S)Oc1ccc(NC(C)=O)cc1 |
|---|
| InChI Key | XFVUVMMMZIFVJD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic thiophosphoric acids and derivatives |
|---|
| Subclass | thiophosphoric acid esters |
|---|
| Direct Parent | phenyl thiophosphates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesacetanilidescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundsphenoxy compoundssecondary carboxylic acid amidesthiophosphate diesters |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupn-acetylarylaminen-arylamidecarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundacetamideacetanilidephenyl thiophosphatecarboxamide groupthiophosphate diesteraromatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
