| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:27:07 UTC |
|---|
| Update Date | 2025-03-21 18:39:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00127332 |
|---|
| Frequency | 20.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H10O8S |
|---|
| Molecular Mass | 230.0096 |
|---|
| SMILES | O=C(C(O)C(O)C(O)CO)S(=O)(=O)O |
|---|
| InChI Key | BYXKIMSHQBDFSU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acylsulfonic acidscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganic sulfonic acids and derivativesprimary alcoholssecondary alcoholssulfonylsthiolactones |
|---|
| Substituents | acylsulfonic acidalcoholaliphatic acyclic compoundcarbonyl groupacylsulfonic acid or derivativesmonosaccharideorganosulfur compoundcarboxylic acid derivativeorganic oxidesulfonylorganic sulfonic acid or derivativessecondary alcoholhydrocarbon derivativeprimary alcoholthiolactone |
|---|
