| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:27:10 UTC |
|---|
| Update Date | 2025-03-21 18:39:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00127449 |
|---|
| Frequency | 20.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O2 |
|---|
| Molecular Mass | 226.0994 |
|---|
| SMILES | COc1ccc2c(c1)-c1cc(O)ccc1CC2 |
|---|
| InChI Key | KEMXNGGASLIAOG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisoleshydrocarbon derivativesnaphthols and derivatives |
|---|
| Substituents | phenol etherphenanthreneether1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundalkyl aryl ethernaphthaleneorganic oxygen compoundanisolehydrocarbon derivative2-naphtholorganooxygen compound |
|---|
