| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:27:12 UTC |
|---|
| Update Date | 2025-03-21 18:39:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00127527 |
|---|
| Frequency | 20.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H20N2O |
|---|
| Molecular Mass | 220.1576 |
|---|
| SMILES | CCCN(CCC)C(=O)c1ccc(N)cc1 |
|---|
| InChI Key | YZZJRTKRDSVWQU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminestertiary carboxylic acid amides |
|---|
| Substituents | amino acid or derivativesbenzoylcarboxamide groupcarboxylic acid derivativebenzamidearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
