| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:27:18 UTC |
|---|
| Update Date | 2025-03-21 18:39:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00127767 |
|---|
| Frequency | 20.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H12NO8P |
|---|
| Molecular Mass | 257.0301 |
|---|
| SMILES | NC(COP(=O)(O)OCC(O)C=O)C(=O)O |
|---|
| InChI Key | CGEMEZSCENOJPV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | glyceraldehyde-3-phosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidsalpha-hydroxyaldehydescarboxylic acidsdialkyl phosphateshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphosphoethanolaminessecondary alcohols |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidalpha-amino acid or derivativescarboxylic acid derivativephosphoethanolamineorganic oxidealpha-hydroxyaldehydeglyceraldehyde-3-phosphateorganonitrogen compoundalpha-amino acidorganopnictogen compoundalcoholaldehydedialkyl phosphatemonocarboxylic acid or derivativesphosphoric acid estersecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|
