| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:27:21 UTC |
|---|
| Update Date | 2025-03-21 18:39:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00127868 |
|---|
| Frequency | 20.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H10O6 |
|---|
| Molecular Mass | 262.0477 |
|---|
| SMILES | O=C(Oc1ccc(O)cc1)c1cc(O)c(O)c(O)c1 |
|---|
| InChI Key | NKNOYFMXMUZDFM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | depsides and depsidones |
|---|
| Subclass | depsides and depsidones |
|---|
| Direct Parent | depsides and depsidones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzoyl derivativescarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsphenol estersphenoxy compoundspyrogallols and derivativesm-hydroxybenzoic acid estersp-hydroxybenzoic acid esters |
|---|
| Substituents | monocyclic benzene moietypyrogallol derivativebenzenetriolp-hydroxybenzoic acid esterbenzoyl1-hydroxy-2-unsubstituted benzenoidbenzoic acid or derivativesbenzoate ester1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterphenol esterphenolhydrocarbon derivativebenzenoidphenoxy compoundm-hydroxybenzoic acid esterorganooxygen compounddepside backbone |
|---|
