| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:27:23 UTC |
|---|
| Update Date | 2025-03-21 18:39:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00127958 |
|---|
| Frequency | 19.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H15NO8 |
|---|
| Molecular Mass | 265.0798 |
|---|
| SMILES | O=C(O)CC(=O)NC1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | GYFGCYRPQRECDH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidmonosaccharidecarboxamide groupcarboxylic acid derivativeoxacyclesecondary carboxylic acid amideorganic oxidemonocarboxylic acid or derivativesaliphatic heteromonocyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundoxaneprimary alcoholorganoheterocyclic compound |
|---|
