| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:27:23 UTC |
|---|
| Update Date | 2025-03-21 18:39:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00127981 |
|---|
| Frequency | 19.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H16O3 |
|---|
| Molecular Mass | 268.1099 |
|---|
| SMILES | COc1ccc(C=CC(=O)c2ccc(OC)cc2)cc1 |
|---|
| InChI Key | HDXVSZWKIHQDES-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | linear 1,3-diarylpropanoids |
|---|
| Direct Parent | linear 1,3-diarylpropanoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalpha,beta-unsaturated ketonesanisolesaryl ketonesbenzoyl derivativescinnamic acids and derivativeshydrocarbon derivativesmethoxybenzenesorganic oxidesphenoxy compounds |
|---|
| Substituents | linear 1,3-diarylpropanoidphenol ethermonocyclic benzene moietyetherbenzoylalkyl aryl etheralpha,beta-unsaturated ketonemethoxybenzeneketonearomatic homomonocyclic compoundcinnamic acid or derivativesorganic oxideorganic oxygen compoundanisolehydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compoundaryl ketone |
|---|
