| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:27:27 UTC |
|---|
| Update Date | 2025-03-21 18:40:01 UTC |
|---|
| HMDB ID | HMDB0010334 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00128150 |
|---|
| Name | Ketoprofen glucuronide |
|---|
| Frequency | 19.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H22O9 |
|---|
| Molecular Mass | 430.1264 |
|---|
| SMILES | CC(C(=O)OC1OC(C(=O)O)C(O)C(O)C1O)c1cccc(C(=O)c2ccccc2)c1 |
|---|
| InChI Key | PBTXSZZKPHBHMA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsaryl ketonesaryl-phenylketonesbenzoyl derivativesbeta hydroxy acids and derivativescarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativesdiphenylmethanesglucuronic acid derivativeshydrocarbon derivativesmonosaccharideso-glucuronidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcohols |
|---|
| Substituents | diphenylmethanecarbonyl groupcarboxylic acidglucuronic acid or derivativesaromatic heteromonocyclic compoundbenzoylo-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acidbenzophenoneketone1-o-glucuronidebeta-hydroxy acidsaccharideorganic oxideacetaloxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesaryl-phenylketonehydroxy acidoxacycleorganic oxygen compoundpyrancarboxylic acid estersecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeorganooxygen compoundaryl ketone |
|---|
