| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:27:28 UTC |
|---|
| Update Date | 2025-03-21 18:40:01 UTC |
|---|
| HMDB ID | HMDB0033986 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00128182 |
|---|
| Name | Demethylvestitol |
|---|
| Frequency | 19.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O4 |
|---|
| Molecular Mass | 258.0892 |
|---|
| SMILES | Oc1ccc(C2COc3cc(O)ccc3C2)c(O)c1 |
|---|
| InChI Key | CJZBXHPHEBCWLV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflavans |
|---|
| Direct Parent | isoflavanols |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersbenzene and substituted derivativeshydrocarbon derivativesoxacyclic compoundsresorcinols |
|---|
| Substituents | monocyclic benzene moietyetherbenzopyran1-benzopyranisoflavanol1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidalkyl aryl etherresorcinoloxacycleorganic oxygen compoundaromatic heteropolycyclic compoundchromanephenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|
