| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:27:42 UTC |
|---|
| Update Date | 2025-03-21 18:40:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00128753 |
|---|
| Frequency | 19.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H24O12 |
|---|
| Molecular Mass | 432.1268 |
|---|
| SMILES | O=C(CCC(=O)OCOC1OC(C(O)O)C(O)C(O)C1O)Cc1cc(O)cc(O)c1 |
|---|
| InChI Key | GACUQFHFFNNKEN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | benzenediols |
|---|
| Direct Parent | resorcinols |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsbenzene and substituted derivativescarbonyl hydratescarboxylic acid estersfatty acid estersgamma-keto acids and derivativeshydrocarbon derivativesketonesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | fatty acylmonocyclic benzene moietycarbonyl groupcarbonyl hydratearomatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidmonosaccharidecarboxylic acid derivativeresorcinolketonesaccharideorganic oxideacetaloxaneorganoheterocyclic compoundalcohol1-hydroxy-4-unsubstituted benzenoidgamma-keto acidoxacyclefatty acid estermonocarboxylic acid or derivativesorganic oxygen compoundketo acidcarboxylic acid estersecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
