| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:27:56 UTC |
|---|
| Update Date | 2025-03-21 18:40:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00129275 |
|---|
| Frequency | 19.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H13NO6 |
|---|
| Molecular Mass | 219.0743 |
|---|
| SMILES | CC(=O)NC1OCC(O)(C(=O)O)CC1O |
|---|
| InChI Key | RSTWDBCNXJORNY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | oxanes |
|---|
| Subclass | oxanes |
|---|
| Direct Parent | oxanes |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssecondary alcoholssecondary carboxylic acid amidestertiary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidalpha-hydroxy acidhydroxy acidcarboxamide groupcarboxylic acid derivativeoxacyclesecondary carboxylic acid amidetertiary alcoholorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaliphatic heteromonocyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundoxaneacetamideorganooxygen compound |
|---|
