| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:27:57 UTC |
|---|
| Update Date | 2025-03-21 18:40:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00129326 |
|---|
| Frequency | 19.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O10 |
|---|
| Molecular Mass | 354.0587 |
|---|
| SMILES | O=C(O)CC(O)(CC(=O)OC(=O)C=Cc1ccc(O)c(O)c1)C(=O)O |
|---|
| InChI Key | PXNPXJFUXNGSHE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tetracarboxylic acids and derivatives |
|---|
| Direct Parent | tetracarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalpha hydroxy acids and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acid anhydridescarboxylic acidshydrocarbon derivativeshydroxycinnamic acidsorganic oxidestertiary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietycarbonyl groupcarboxylic acidalpha-hydroxy acid1-hydroxy-2-unsubstituted benzenoidtetracarboxylic acid or derivativeshydroxy acid1-hydroxy-4-unsubstituted benzenoidhydroxycinnamic acid or derivativeshydroxycinnamic acidaromatic homomonocyclic compoundcinnamic acid or derivativestertiary alcoholorganic oxideorganic oxygen compoundcarboxylic acid anhydridephenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
