| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:27:59 UTC |
|---|
| Update Date | 2025-03-21 18:40:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00129381 |
|---|
| Frequency | 19.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H8O10S |
|---|
| Molecular Mass | 271.9838 |
|---|
| SMILES | O=C(O)C1OC(OS(=O)(=O)O)=C(O)C(O)C1O |
|---|
| InChI Key | PKGXRGAVZYWSKU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyran carboxylic acids and derivatives |
|---|
| Direct Parent | pyran carboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundssecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | alcoholsulfuric acid monoestercarbonyl groupcarboxylic acidpyran carboxylic acid or derivativesorganic sulfuric acid or derivativeshydroxy acidcarboxylic acid derivativeoxacyclebeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaliphatic heteromonocyclic compoundsecondary alcoholsulfate-esterhydrocarbon derivativesulfuric acid esterorganooxygen compound1,2-diol |
|---|
