| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:28:03 UTC |
|---|
| Update Date | 2025-03-21 18:40:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00129565 |
|---|
| Frequency | 19.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H16N3O7P |
|---|
| Molecular Mass | 321.0726 |
|---|
| SMILES | CNc1ccn(C2CC(O)C(COP(=O)(O)O)O2)c(=O)n1 |
|---|
| InChI Key | RJSNFYLMWHHPIJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyrimidine nucleotides |
|---|
| Subclass | pyrimidine deoxyribonucleotides |
|---|
| Direct Parent | pyrimidine 2'-deoxyribonucleoside monophosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsmonoalkyl phosphatesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundspentose phosphatespyrimidonessecondary alcoholssecondary alkylarylaminestetrahydrofurans |
|---|
| Substituents | aromatic heteromonocyclic compoundpentose phosphatemonosaccharidepyrimidonepyrimidinepyrimidine 2'-deoxyribonucleoside monophosphatesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundimidolactamorganoheterocyclic compoundalcoholcarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundsecondary aminesecondary aliphatic/aromatic amineoxacycleorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compoundamine |
|---|
