| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:28:06 UTC |
|---|
| Update Date | 2025-03-21 18:40:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00129675 |
|---|
| Frequency | 19.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H18N2O |
|---|
| Molecular Mass | 218.1419 |
|---|
| SMILES | Cc1ccccc1C(=O)N1CCN(C)CC1 |
|---|
| InChI Key | OVUHXNVSFDPYNP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundsbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesn-methylpiperazinesorganic oxidesorganooxygen compoundsorganopnictogen compoundstertiary carboxylic acid amidestrialkylamineso-toluamides |
|---|
| Substituents | aromatic heteromonocyclic compoundamino acid or derivativesbenzoylcarboxylic acid derivativetoluamidebenzamideorganic oxideo-toluamidepiperazinetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundtertiary amineorganoheterocyclic compoundazacyclen-alkylpiperazinetertiary aliphatic aminen-methylpiperazinecarboxamide grouporganic oxygen compound1,4-diazinanehydrocarbon derivativeorganic nitrogen compoundtolueneamineorganooxygen compound |
|---|
