| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:28:06 UTC |
|---|
| Update Date | 2025-03-21 18:40:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00129692 |
|---|
| Frequency | 38.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H4N4O5S |
|---|
| Molecular Mass | 231.9902 |
|---|
| SMILES | O=S(=O)(O)Oc1nc(O)c2[nH]cnc2n1 |
|---|
| InChI Key | FKQMICVFRIDKIF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | arylsulfates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroxypyrimidinesimidazolesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspurines and purine derivativessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoesterazacycleheteroaromatic compoundhydroxypyrimidineimidazopyrimidinepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundsulfate-esterhydrocarbon derivativearylsulfatepurineorganic nitrogen compoundsulfuric acid esterorganoheterocyclic compoundorganooxygen compoundazole |
|---|
