| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:28:08 UTC |
|---|
| Update Date | 2025-03-21 18:40:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00129742 |
|---|
| Frequency | 33.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12N3O6PS |
|---|
| Molecular Mass | 321.0184 |
|---|
| SMILES | Nc1ccn(C2OC(CO)C3OP(O)(=S)OC32)c(=O)n1 |
|---|
| InChI Key | GOHXEQCYXOZLAW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdioxaphospholanesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminestetrahydrofuransthiophosphate diesters |
|---|
| Substituents | thiophosphoric acid esterpyrimidoneorganic thiophosphoric acid or derivativesorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundprimary alcoholimidolactamalcoholcarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compound1,3_dioxaphospholanethiophosphate diesteroxacycleorganic oxygen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
