| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:28:08 UTC |
|---|
| Update Date | 2025-03-21 18:40:21 UTC |
|---|
| HMDB ID | HMDB0132128 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00129774 |
|---|
| Name | 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-8-methoxy-4H-chromen-4-one |
|---|
| Frequency | 19.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O7 |
|---|
| Molecular Mass | 316.0583 |
|---|
| SMILES | COc1c(O)cc(O)c2c(=O)c(O)c(-c3ccc(O)cc3)oc12 |
|---|
| InChI Key | AZFYHRHUTXBGJS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavones |
|---|
| Direct Parent | flavonols |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids3-hydroxyflavonoids4'-hydroxyflavonoids5-hydroxyflavonoids7-hydroxyflavonoids8-o-methylated flavonoidsalkyl aryl ethersanisolesbenzene and substituted derivativeschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesoxacyclic compoundspyranones and derivativesvinylogous acids |
|---|
| Substituents | 3-hydroxyflavonephenol ethermonocyclic benzene moiety3-hydroxyflavonoidether1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundbenzopyranheteroaromatic compound5-hydroxyflavonoid8-methoxyflavonoid-skeletonoxacyclevinylogous acidorganic oxygen compoundpyrananisole7-hydroxyflavonoid4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
