Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 00:28:08 UTC |
---|
Update Date | 2025-03-21 18:40:21 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00129777 |
---|
Frequency | 19.6 |
---|
Structure | |
---|
Chemical Formula | C18H27N3O5 |
---|
Molecular Mass | 365.1951 |
---|
SMILES | CCC(C)C(NC(=O)C(CO)NC(=O)C(N)Cc1ccccc1)C(=O)O |
---|
InChI Key | JXQVYPWVGUOIDV-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic polymers |
---|
Class | polypeptides |
---|
Subclass | polypeptides |
---|
Direct Parent | polypeptides |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alpha amino acid amidesalpha amino acidsamphetamines and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acidsfatty amideshydrocarbon derivativesisoleucine and derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundspeptidesphenylalanine and derivativesprimary alcoholssecondary carboxylic acid amidesserine and derivatives |
---|
Substituents | fatty acylmonocyclic benzene moietycarbonyl groupcarboxylic acidfatty amidealpha-amino acid or derivativescarboxylic acid derivativealpha peptideorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundprimary alcoholisoleucine or derivativesamphetamine or derivativesn-acyl-alpha amino acid or derivativesalcoholpolypeptidealpha-amino acid amiden-acyl-alpha-amino acidcarboxamide groupn-substituted-alpha-amino acidaromatic homomonocyclic compoundsecondary carboxylic acid amidemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundserine or derivativesorganooxygen compound |
---|