| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:28:11 UTC |
|---|
| Update Date | 2025-03-21 18:40:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00129873 |
|---|
| Frequency | 45.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H11ClN4O4 |
|---|
| Molecular Mass | 286.0469 |
|---|
| SMILES | O=c1[nH]cnc2c1ncn2C1OC(CO)C(Cl)C1O |
|---|
| InChI Key | UXSXGLIBPUUQAJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleosides |
|---|
| Subclass | purine 3'-deoxyribonucleosides |
|---|
| Direct Parent | purine 3'-deoxyribonucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl chloridesazacyclic compoundschlorohydrinsheteroaromatic compoundshydrocarbon derivativeshypoxanthinesimidazoleslactamsn-substituted imidazolesorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholspurines and purine derivativespyrimidonessecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | lactamchlorohydrinalkyl chlorideorganochloridepyrimidoneimidazopyrimidineorganohalogen compoundpyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundalkyl halideprimary alcoholorganoheterocyclic compoundazolen-substituted imidazolealcoholvinylogous amideazacycletetrahydrofuranhalohydrinheteroaromatic compoundoxacyclepurine 3'-deoxyribonucleosideorganic oxygen compoundsecondary alcoholhypoxanthinehydrocarbon derivativepurineorganic nitrogen compoundorganooxygen compound |
|---|