| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:28:11 UTC |
|---|
| Update Date | 2025-03-21 18:40:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00129890 |
|---|
| Frequency | 19.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H15FO3 |
|---|
| Molecular Mass | 274.1005 |
|---|
| SMILES | CC(C(=O)O)c1cccc(C(O)c2ccc(F)cc2)c1 |
|---|
| InChI Key | DWNBKMRRWYJYLI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsaryl fluoridescarbonyl compoundscarboxylic acidsfluorobenzeneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganofluoridesphenylpropanoic acidssecondary alcohols |
|---|
| Substituents | aryl fluoridearomatic alcoholalcoholdiphenylmethanecarbonyl groupcarboxylic acidorganofluoridecarboxylic acid derivativeorganohalogen compoundaryl halidearomatic homomonocyclic compoundfluorobenzeneorganic oxidemonocarboxylic acid or derivativesorganic oxygen compound2-phenylpropanoic-acidsecondary alcoholhydrocarbon derivativehalobenzeneorganooxygen compound |
|---|
