Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-21 00:28:19 UTC |
---|
Update Date | 2025-03-21 18:40:28 UTC |
---|
HMDB ID | HMDB0015401 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00130214 |
---|
Name | Nelarabine |
---|
Frequency | 19.5 |
---|
Structure | |
---|
Chemical Formula | C11H15N5O5 |
---|
Molecular Mass | 297.1073 |
---|
SMILES | COc1nc(N)nc2c1ncn2C1OC(CO)C(O)C1O |
---|
InChI Key | IXOXBSCIXZEQEQ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | nucleosides, nucleotides, and analogues |
---|
Class | purine nucleosides |
---|
Subclass | purine nucleosides |
---|
Direct Parent | purine nucleosides |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | alkyl aryl ethersazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesmonosaccharidesn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholstetrahydrofurans |
---|
Substituents | ethermonosaccharideimidazopyrimidinealkyl aryl etherpyrimidinesaccharidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycletetrahydrofuranpurine nucleosideheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
---|