| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:28:23 UTC |
|---|
| Update Date | 2025-03-21 18:40:31 UTC |
|---|
| HMDB ID | HMDB0031510 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00130343 |
|---|
| Name | R-2-Hydroxy-3-methylbutanoic acid 3-Methylbutanoyl |
|---|
| Frequency | 19.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H18O4 |
|---|
| Molecular Mass | 202.1205 |
|---|
| SMILES | CC(C)CC(=O)OC(C(=O)O)C(C)C |
|---|
| InChI Key | SOJFCTIYHPWXGZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acid esters |
|---|
| Direct Parent | fatty acid esters |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesmethyl-branched fatty acidsorganic oxidesshort-chain hydroxy acids and derivatives |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidmethyl-branched fatty acidshort-chain hydroxy acidcarboxylic acid derivativebranched fatty acidfatty acid esterorganic oxideorganic oxygen compoundcarboxylic acid esterdicarboxylic acid or derivativeshydrocarbon derivativeorganooxygen compound |
|---|
