| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:28:24 UTC |
|---|
| Update Date | 2025-03-21 18:40:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00130396 |
|---|
| Frequency | 19.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H10O8S |
|---|
| Molecular Mass | 242.0096 |
|---|
| SMILES | O=S(=O)(O)OC1=C(O)C(C(O)CO)OC1 |
|---|
| InChI Key | MUJKZIGFUSRJFW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid esters |
|---|
| Direct Parent | sulfuric acid monoesters |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsdialkyl ethersdihydrofuranshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholsulfuric acid monoesterethermonosaccharidedialkyl etheroxacyclesaccharideorganic oxideorganic oxygen compoundaliphatic heteromonocyclic compoundsecondary alcoholsulfate-esterhydrocarbon derivativeprimary alcoholorganoheterocyclic compoundorganooxygen compound1,2-dioldihydrofuran |
|---|
