| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:28:25 UTC |
|---|
| Update Date | 2025-03-21 18:40:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00130423 |
|---|
| Frequency | 19.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H31ClN2O4 |
|---|
| Molecular Mass | 398.1972 |
|---|
| SMILES | CC(C)(CO)C(O)C(=O)NCCCN1CCC(O)(c2ccc(Cl)cc2)CC1 |
|---|
| InChI Key | VEMXIEIFNVAMGP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | phenylpiperidines |
|---|
| Direct Parent | phenylpiperidines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaryl chloridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeschlorobenzeneshydrocarbon derivativesmonosaccharidesn-acyl aminesorganic oxidesorganochloridesorganopnictogen compoundssecondary alcoholssecondary carboxylic acid amidestertiary alcoholstrialkylamines |
|---|
| Substituents | fatty acylmonocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativesorganochloridefatty amidemonosaccharidecarboxylic acid derivativeorganohalogen compoundsaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundtertiary aminearyl chloridechlorobenzenealcoholazacycletertiary aliphatic aminecarboxamide groupn-acyl-aminearyl halidesecondary carboxylic acid amidetertiary alcoholorganic oxygen compoundphenylpiperidinesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzeneamineorganooxygen compound |
|---|