| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:28:32 UTC |
|---|
| Update Date | 2025-03-21 18:40:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00130709 |
|---|
| Frequency | 19.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H8O7S2 |
|---|
| Molecular Mass | 303.9711 |
|---|
| SMILES | O=S(=O)(O)Oc1cccc2cccc(S(=O)(=O)O)c12 |
|---|
| InChI Key | AGPJWANHIAZWTD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalene sulfonic acids and derivatives |
|---|
| Direct Parent | 1-naphthalene sulfonic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-naphthalene sulfonates1-sulfo,2-unsubstituted aromatic compoundsarylsulfatesarylsulfonic acids and derivativeshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganosulfonic acidssulfonylssulfuric acid monoesters |
|---|
| Substituents | organosulfonic acid or derivativessulfuric acid monoesterorganic sulfuric acid or derivatives1-sulfo,2-unsubstituted aromatic compoundorganosulfonic acidaromatic homopolycyclic compoundorganosulfur compound1-naphthalene sulfonic acid or derivatives1-naphthalene sulfonateorganic oxidesulfonylarylsulfonic acid or derivativesorganic oxygen compoundorganic sulfonic acid or derivativesnaphthalene sulfonatesulfate-esterhydrocarbon derivativearylsulfatesulfuric acid esterorganooxygen compound |
|---|
