| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:28:34 UTC |
|---|
| Update Date | 2025-03-21 18:40:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00130796 |
|---|
| Frequency | 19.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H18O4 |
|---|
| Molecular Mass | 250.1205 |
|---|
| SMILES | COC(=O)c1cccc(C(=O)OCC(C)(C)C)c1 |
|---|
| InChI Key | HVVVEUXOGVCNBX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | m-phthalate esters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzoic acid estersbenzoyl derivativesdicarboxylic acids and derivativeshydrocarbon derivativesm-phthalic acid and derivativesmethyl estersorganic oxidesorganooxygen compounds |
|---|
| Substituents | meta-phthalic acid esterbenzoylbenzoate estercarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemethyl esterorganic oxygen compoundcarboxylic acid esterdicarboxylic acid or derivativesmeta_phthalic_acidhydrocarbon derivativeorganooxygen compound |
|---|
