| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:28:36 UTC |
|---|
| Update Date | 2025-03-21 18:40:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00130901 |
|---|
| Frequency | 19.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H19N3O2S |
|---|
| Molecular Mass | 257.1198 |
|---|
| SMILES | NC(=O)CCCCC1CSCC2NC(=O)NC12 |
|---|
| InChI Key | KKXFIUGVUURYEL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | thianes |
|---|
| Subclass | thianes |
|---|
| Direct Parent | thianes |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylthioethersfatty amideshydrocarbon derivativesimidazolidinonesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary carboxylic acid amides |
|---|
| Substituents | imidazolidineprimary carboxylic acid amidefatty acylcarbonyl groupcarbonic acid derivativeazacycledialkylthioetherfatty amidecarboxamide groupcarboxylic acid derivativealiphatic heteropolycyclic compoundimidazolidinoneorganic oxideorganic oxygen compoundthioetherorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundthiane |
|---|
