| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:28:38 UTC |
|---|
| Update Date | 2025-03-21 18:40:43 UTC |
|---|
| HMDB ID | HMDB0240693 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00130985 |
|---|
| Name | 2-(3,5-Dihydroxyphenyl)ethanol sulfate |
|---|
| Frequency | 19.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10O6S |
|---|
| Molecular Mass | 234.0198 |
|---|
| SMILES | O=S(=O)(O)Oc1cc(O)cc(CCO)c1 |
|---|
| InChI Key | QGXITCCVKOBDDI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalcohols and polyolshydrocarbon derivativesorganic oxidesphenoxy compoundssulfuric acid monoesters |
|---|
| Substituents | alcoholmonocyclic benzene moietysulfuric acid monoester1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compoundphenylsulfateorganic oxideorganic oxygen compoundsulfate-esterphenolhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|
