| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:28:46 UTC |
|---|
| Update Date | 2025-03-21 18:40:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00131282 |
|---|
| Frequency | 19.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H8O4 |
|---|
| Molecular Mass | 216.0423 |
|---|
| SMILES | CC1=CC(=O)c2ccc(C(=O)O)cc2C1=O |
|---|
| InChI Key | BPILPCSXCKXDJH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalenecarboxylic acids and derivatives |
|---|
| Direct Parent | naphthalenecarboxylic acids |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | aryl ketonescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesnaphthoquinonesorganic oxidesorganooxygen compoundsquinones |
|---|
| Substituents | carboxylic acidaromatic homopolycyclic compoundcarboxylic acid derivativeketoneorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivative2-naphthalenecarboxylic acidnaphthoquinoneorganooxygen compoundaryl ketonequinone |
|---|
