| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:28:50 UTC |
|---|
| Update Date | 2025-03-21 18:40:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00131422 |
|---|
| Frequency | 19.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H8O6S |
|---|
| Molecular Mass | 244.0042 |
|---|
| SMILES | O=C1CCc2c(O)cc(OS(=O)O)cc2O1 |
|---|
| InChI Key | DOTSFMOHRLMNJE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | 3,4-dihydrocoumarins |
|---|
| Subclass | 3,4-dihydrocoumarins |
|---|
| Direct Parent | 3,4-dihydrocoumarins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzenoidscarbonyl compoundscarboxylic acid estershydrocarbon derivativeslactonesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compounds |
|---|
| Substituents | carbonyl groupbenzopyran1-benzopyran3,4-dihydrocoumarin1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativelactoneoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaromatic heteropolycyclic compoundcarboxylic acid esterchromanehydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|