| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:28:50 UTC |
|---|
| Update Date | 2025-03-21 18:40:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00131423 |
|---|
| Frequency | 19.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H14O8 |
|---|
| Molecular Mass | 250.0689 |
|---|
| SMILES | CC(=O)OC(=O)CC(O)(CC(=O)O)C(O)CO |
|---|
| InChI Key | TUJOXQUSDKSHGK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid anhydridescarboxylic acidshydrocarbon derivativesorganic oxidesprimary alcoholssecondary alcoholstertiary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupcarboxylic acidtricarboxylic acid or derivativestertiary alcoholorganic oxideorganic oxygen compoundcarboxylic acid anhydridesecondary alcoholhydrocarbon derivativeprimary alcoholorganooxygen compound |
|---|
