| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:28:51 UTC |
|---|
| Update Date | 2025-03-21 18:40:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00131459 |
|---|
| Frequency | 19.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C30H36N2O2 |
|---|
| Molecular Mass | 456.2777 |
|---|
| SMILES | Cc1ccc(C2(O)CCN(CCC(C(=O)N(C)C)(c3ccccc3)c3ccccc3)CC2)cc1 |
|---|
| InChI Key | MUKGYYFUUFOKCM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acyl aminesorganic oxidesorganopnictogen compoundsphenylacetamidesphenylpiperidinestertiary alcoholstertiary carboxylic acid amidestoluenestrialkylamines |
|---|
| Substituents | diphenylmethanecarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativescarboxylic acid derivativeorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundpiperidinephenylacetamidetertiary amineorganoheterocyclic compoundalcoholazacycletertiary aliphatic aminecarboxamide groupn-acyl-aminetertiary alcoholorganic oxygen compoundphenylpiperidinehydrocarbon derivativeorganic nitrogen compoundtolueneamineorganooxygen compound |
|---|
