| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:28:51 UTC |
|---|
| Update Date | 2025-03-21 18:40:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00131460 |
|---|
| Frequency | 19.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10N4O2 |
|---|
| Molecular Mass | 194.0804 |
|---|
| SMILES | O=C1CNC(Cc2cnc[nH]2)C(=O)N1 |
|---|
| InChI Key | UCVNIYWLNUBABH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylaminesdicarboximidesdioxopiperazinesheteroaromatic compoundshydrocarbon derivativesimidazolesn-unsubstituted carboxylic acid imidesorganic oxidesorganopnictogen compounds |
|---|
| Substituents | carbonyl grouparomatic heteromonocyclic compoundcarboxylic acid imide, n-unsubstitutedorganic oxidedioxopiperazinepiperazineimidazoleorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximideorganoheterocyclic compoundazolesecondary aliphatic amineazacycleheteroaromatic compoundsecondary aminecarboxylic acid imideorganic oxygen compound1,4-diazinanehydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundamine |
|---|
