| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:28:53 UTC |
|---|
| Update Date | 2025-03-21 18:40:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00131543 |
|---|
| Frequency | 19.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C25H40O2 |
|---|
| Molecular Mass | 372.3028 |
|---|
| SMILES | CC(CC=O)C1CCC2C3=C(CCC21C)C1(C)CCC(O)C(C)(C)C1CC3 |
|---|
| InChI Key | DJSKRJOAZUUSOO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | bile acids, alcohols and derivatives |
|---|
| Direct Parent | bile acids, alcohols and derivatives |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | 3-hydroxysteroidsalpha-hydrogen aldehydescyclic alcohols and derivativesditerpenoidshydrocarbon derivativesorganic oxidesoxosteroidssecondary alcohols |
|---|
| Substituents | alcoholcarbonyl group23-oxosteroidoxosteroidabietane diterpenoid3-hydroxysteroidaldehydehydroxysteroidcyclic alcoholbile acid, alcohol, or derivativesaliphatic homopolycyclic compoundorganic oxideorganic oxygen compoundalpha-hydrogen aldehydesecondary alcoholhydrocarbon derivativediterpenoidorganooxygen compound |
|---|
