| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:29:02 UTC |
|---|
| Update Date | 2025-03-21 18:40:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00131904 |
|---|
| Frequency | 19.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H16N4O2 |
|---|
| Molecular Mass | 236.1273 |
|---|
| SMILES | Cc1ncc(CNC2C=CC(O)C2O)c(N)n1 |
|---|
| InChI Key | LUMYKLVQUTWNFU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidines and pyrimidine derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsdialkylaminesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganopnictogen compoundsprimary aminessecondary alcohols |
|---|
| Substituents | alcoholsecondary aliphatic aminearomatic heteromonocyclic compoundazacycleheteroaromatic compoundsecondary aminepyrimidineorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundimidolactamamineorganooxygen compound1,2-diol |
|---|
