| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:29:02 UTC |
|---|
| Update Date | 2025-03-21 18:40:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00131916 |
|---|
| Frequency | 26.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H8O9P2S |
|---|
| Molecular Mass | 281.9364 |
|---|
| SMILES | O=C(OP(=O)(O)O)C(O)COP(O)(O)=S |
|---|
| InChI Key | XPZKXBKITNLXIN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | acyl monophosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganic phosphoric acids and derivativessecondary alcoholssugar acids and derivativesthiophosphate monoesters |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupthiophosphoric acid esteracyl monophosphatemonosaccharidecarboxylic acid derivativethiophosphate monoesterorganic thiophosphoric acid or derivativessaccharideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundglyceric_acidsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
