| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:29:09 UTC |
|---|
| Update Date | 2025-03-21 18:41:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00132185 |
|---|
| Frequency | 19.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H19NO3 |
|---|
| Molecular Mass | 249.1365 |
|---|
| SMILES | Cc1cccc(C)c1NC(=O)CCCCC(=O)O |
|---|
| InChI Key | RGVITYOZTOLYJV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | anilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amino fatty acidscarbocyclic fatty acidscarbonyl compoundscarboxylic acidsfatty amideshydrocarbon derivativesmedium-chain fatty acidsmonocarboxylic acids and derivativesn-arylamidesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amidesm-xylenes |
|---|
| Substituents | fatty acylcarbocyclic fatty acidcarbonyl groupcarboxylic acidfatty amidefatty acidn-arylamidecarboxylic acid derivativexyleneorganic oxideorganonitrogen compoundorganopnictogen compoundmedium-chain fatty acidm-xylenecarboxamide groupamino fatty acidaromatic homomonocyclic compoundanilidesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
