| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:29:10 UTC |
|---|
| Update Date | 2025-03-21 18:41:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00132213 |
|---|
| Frequency | 19.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H8O7S2 |
|---|
| Molecular Mass | 279.9711 |
|---|
| SMILES | O=S(=O)(O)C=Cc1ccc(OS(=O)(=O)O)cc1 |
|---|
| InChI Key | ISMJEEAQVZYKKZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganic oxidesorganooxygen compoundsorganosulfonic acidsphenoxy compoundssulfonylssulfuric acid monoesters |
|---|
| Substituents | organosulfonic acid or derivativesmonocyclic benzene moietysulfuric acid monoesterorganosulfonic acidorganosulfur compoundaromatic homomonocyclic compoundphenylsulfateorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativessulfate-esterhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|
